C14H19Cl2N3OS — CID 165342477
3,4-dichloro-N-[2-(2-methylpropylcarbamothioylamino)ethyl]benzamide (PubChem CID 165342477) has the molecular formula C14H19Cl2N3OS and a molecular weight of 348.30 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(2-methylpropylcarbamothioylamino)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(2-methylpropylcarbamothioylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 165342477 |
| Molecular Formula | C14H19Cl2N3OS |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 3,4-dichloro-N-[2-(2-methylpropylcarbamothioylamino)ethyl]benzamide |
| SMILES | CC(C)CNC(=S)NCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2N3OS/c1-9(2)8-19-14(21)18-6-5-17-13(20)10-3-4-11(15)12(16)7-10/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,20)(H2,18,19,21) |
| InChIKey | RCBCCOTXXBENNI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|