C11H14Cl2N2O3S — CID 38426855
3,4-dichloro-N-[2-(ethylsulfonylamino)ethyl]benzamide (PubChem CID 38426855) has the molecular formula C11H14Cl2N2O3S and a molecular weight of 325.22 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(ethylsulfonylamino)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(ethylsulfonylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 38426855 |
| Molecular Formula | C11H14Cl2N2O3S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 3,4-dichloro-N-[2-(ethylsulfonylamino)ethyl]benzamide |
| SMILES | CCS(=O)(=O)NCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O3S/c1-2-19(17,18)15-6-5-14-11(16)8-3-4-9(12)10(13)7-8/h3-4,7,15H,2,5-6H2,1H3,(H,14,16) |
| InChIKey | GTQPQOIYTQGKJM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|