C12H13Cl3N2O2 — CID 108570669
3,4-dichloro-N-[2-(3-chloropropanoylamino)ethyl]benzamide (PubChem CID 108570669) has the molecular formula C12H13Cl3N2O2 and a molecular weight of 323.61 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(3-chloropropanoylamino)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(3-chloropropanoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 108570669 |
| Molecular Formula | C12H13Cl3N2O2 |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 3,4-dichloro-N-[2-(3-chloropropanoylamino)ethyl]benzamide |
| SMILES | O=C(CCCl)NCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl3N2O2/c13-4-3-11(18)16-5-6-17-12(19)8-1-2-9(14)10(15)7-8/h1-2,7H,3-6H2,(H,16,18)(H,17,19) |
| InChIKey | QGNVNNNBFPYYEY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|