C21H26Cl2N2O2 — CID 108537881
N-[2-[[2-(1-adamantyl)acetyl]amino]ethyl]-3,4-dichlorobenzamide (PubChem CID 108537881) has the molecular formula C21H26Cl2N2O2 and a molecular weight of 409.36 g/mol. Its IUPAC name is N-[2-[[2-(1-adamantyl)acetyl]amino]ethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-[[2-(1-adamantyl)acetyl]amino]ethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 108537881 |
| Molecular Formula | C21H26Cl2N2O2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[2-[[2-(1-adamantyl)acetyl]amino]ethyl]-3,4-dichlorobenzamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H26Cl2N2O2/c22-17-2-1-16(8-18(17)23)20(27)25-4-3-24-19(26)12-21-9-13-5-14(10-21)7-15(6-13)11-21/h1-2,8,13-15H,3-7,9-12H2,(H,24,26)(H,25,27) |
| InChIKey | RCZFDYZRGBUIHH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|