C23H30N2O4 — CID 108537447
[3-[2-[[2-(1-adamantyl)acetyl]amino]ethylcarbamoyl]phenyl] acetate (PubChem CID 108537447) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is [3-[2-[[2-(1-adamantyl)acetyl]amino]ethylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[2-[[2-(1-adamantyl)acetyl]amino]ethylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108537447 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | [3-[2-[[2-(1-adamantyl)acetyl]amino]ethylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCCNC(=O)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C23H30N2O4/c1-15(26)29-20-4-2-3-19(10-20)22(28)25-6-5-24-21(27)14-23-11-16-7-17(12-23)9-18(8-16)13-23/h2-4,10,16-18H,5-9,11-14H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | MIABUSYPWPQNII-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|