C20H22N2O5 — CID 108537486
[3-[2-(3-phenoxypropanoylamino)ethylcarbamoyl]phenyl] acetate (PubChem CID 108537486) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is [3-[2-(3-phenoxypropanoylamino)ethylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[2-(3-phenoxypropanoylamino)ethylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108537486 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [3-[2-(3-phenoxypropanoylamino)ethylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCCNC(=O)CCOc2ccccc2)c1 |
| InChI | InChI=1S/C20H22N2O5/c1-15(23)27-18-9-5-6-16(14-18)20(25)22-12-11-21-19(24)10-13-26-17-7-3-2-4-8-17/h2-9,14H,10-13H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | GXIIEKWZDHRRRQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|