C21H24N2O4 — CID 108537502
[3-[2-[3-(4-methylphenyl)propanoylamino]ethylcarbamoyl]phenyl] acetate (PubChem CID 108537502) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is [3-[2-[3-(4-methylphenyl)propanoylamino]ethylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[2-[3-(4-methylphenyl)propanoylamino]ethylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108537502 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [3-[2-[3-(4-methylphenyl)propanoylamino]ethylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCCNC(=O)CCc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C21H24N2O4/c1-15-6-8-17(9-7-15)10-11-20(25)22-12-13-23-21(26)18-4-3-5-19(14-18)27-16(2)24/h3-9,14H,10-13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | SAKXRYWQOGBTEI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|