C20H22N2O4 — CID 108537513
[3-[2-[(3,4-dimethylbenzoyl)amino]ethylcarbamoyl]phenyl] acetate (PubChem CID 108537513) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is [3-[2-[(3,4-dimethylbenzoyl)amino]ethylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[2-[(3,4-dimethylbenzoyl)amino]ethylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108537513 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [3-[2-[(3,4-dimethylbenzoyl)amino]ethylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCCNC(=O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C20H22N2O4/c1-13-7-8-17(11-14(13)2)20(25)22-10-9-21-19(24)16-5-4-6-18(12-16)26-15(3)23/h4-8,11-12H,9-10H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | BKINVQGPUAFIHM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|