C19H21N3O4 — CID 108929458
[3-[3-[(4-aminobenzoyl)amino]propylcarbamoyl]phenyl] acetate (PubChem CID 108929458) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is [3-[3-[(4-aminobenzoyl)amino]propylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[3-[(4-aminobenzoyl)amino]propylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108929458 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | [3-[3-[(4-aminobenzoyl)amino]propylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCCCNC(=O)c2ccc(N)cc2)c1 |
| InChI | InChI=1S/C19H21N3O4/c1-13(23)26-17-5-2-4-15(12-17)19(25)22-11-3-10-21-18(24)14-6-8-16(20)9-7-14/h2,4-9,12H,3,10-11,20H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | KWZCAFTZPOCELQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|