C18H18N2O5 — CID 108537519
[3-[2-[(3-hydroxybenzoyl)amino]ethylcarbamoyl]phenyl] acetate (PubChem CID 108537519) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is [3-[2-[(3-hydroxybenzoyl)amino]ethylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[2-[(3-hydroxybenzoyl)amino]ethylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108537519 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [3-[2-[(3-hydroxybenzoyl)amino]ethylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCCNC(=O)c2cccc(O)c2)c1 |
| InChI | InChI=1S/C18H18N2O5/c1-12(21)25-16-7-3-5-14(11-16)18(24)20-9-8-19-17(23)13-4-2-6-15(22)10-13/h2-7,10-11,22H,8-9H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | XYYYOWHAAZZTNC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|