C20H21FN2O4 — CID 108926954
[3-[2-[3-(2-fluorophenyl)propanoylamino]ethylcarbamoyl]phenyl] acetate (PubChem CID 108926954) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is [3-[2-[3-(2-fluorophenyl)propanoylamino]ethylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[2-[3-(2-fluorophenyl)propanoylamino]ethylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108926954 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [3-[2-[3-(2-fluorophenyl)propanoylamino]ethylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCCNC(=O)CCc2ccccc2F)c1 |
| InChI | InChI=1S/C20H21FN2O4/c1-14(24)27-17-7-4-6-16(13-17)20(26)23-12-11-22-19(25)10-9-15-5-2-3-8-18(15)21/h2-8,13H,9-12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | IJKFUMPQFFDVTA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|