C21H27ClN2O2 — CID 108539477
N-[2-[[2-(1-adamantyl)acetyl]amino]ethyl]-3-chlorobenzamide (PubChem CID 108539477) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is N-[2-[[2-(1-adamantyl)acetyl]amino]ethyl]-3-chlorobenzamide.
| Compound Name | N-[2-[[2-(1-adamantyl)acetyl]amino]ethyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 108539477 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[2-[[2-(1-adamantyl)acetyl]amino]ethyl]-3-chlorobenzamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCCNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H27ClN2O2/c22-18-3-1-2-17(9-18)20(26)24-5-4-23-19(25)13-21-10-14-6-15(11-21)8-16(7-14)12-21/h1-3,9,14-16H,4-8,10-13H2,(H,23,25)(H,24,26) |
| InChIKey | LUAZLHCTQAENNO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|