C9H10ClNO2 — CID 2181761
3-chloro-N-(2-hydroxyethyl)benzamide (PubChem CID 2181761) has the molecular formula C9H10ClNO2 and a molecular weight of 199.64 g/mol. Its IUPAC name is 3-chloro-N-(2-hydroxyethyl)benzamide.
| Compound Name | 3-chloro-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 2181761 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 3-chloro-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(NCCO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H10ClNO2/c10-8-3-1-2-7(6-8)9(13)11-4-5-12/h1-3,6,12H,4-5H2,(H,11,13) |
| InChIKey | WGQQLFYOIGBNNF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |