C16H23ClN2O3 — CID 139824741
tert-butyl N-[4-[(3-chlorobenzoyl)amino]butyl]carbamate (PubChem CID 139824741) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is tert-butyl N-[4-[(3-chlorobenzoyl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(3-chlorobenzoyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 139824741 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | tert-butyl N-[4-[(3-chlorobenzoyl)amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H23ClN2O3/c1-16(2,3)22-15(21)19-10-5-4-9-18-14(20)12-7-6-8-13(17)11-12/h6-8,11H,4-5,9-10H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | YIUUVQVAZHCTBM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|