C13H15ClN2O3 — CID 108571431
prop-2-enyl N-[2-[(3-chlorobenzoyl)amino]ethyl]carbamate (PubChem CID 108571431) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is prop-2-enyl N-[2-[(3-chlorobenzoyl)amino]ethyl]carbamate.
| Compound Name | prop-2-enyl N-[2-[(3-chlorobenzoyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108571431 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | prop-2-enyl N-[2-[(3-chlorobenzoyl)amino]ethyl]carbamate |
| SMILES | C=CCOC(=O)NCCNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15ClN2O3/c1-2-8-19-13(18)16-7-6-15-12(17)10-4-3-5-11(14)9-10/h2-5,9H,1,6-8H2,(H,15,17)(H,16,18) |
| InChIKey | DNMBOSCWONOWSJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|