C17H15ClN2O3 — CID 4926011
3-chloro-N'-(4-prop-2-enoxybenzoyl)benzohydrazide (PubChem CID 4926011) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is 3-chloro-N'-(4-prop-2-enoxybenzoyl)benzohydrazide.
| Compound Name | 3-chloro-N'-(4-prop-2-enoxybenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 4926011 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 3-chloro-N'-(4-prop-2-enoxybenzoyl)benzohydrazide |
| SMILES | C=CCOc1ccc(C(=O)NNC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H15ClN2O3/c1-2-10-23-15-8-6-12(7-9-15)16(21)19-20-17(22)13-4-3-5-14(18)11-13/h2-9,11H,1,10H2,(H,19,21)(H,20,22) |
| InChIKey | OZFGGCSMZZUWNV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|