C29H36N4O6 — CID 4926340
1-N',9-N'-bis(4-prop-2-enoxybenzoyl)nonanedihydrazide (PubChem CID 4926340) has the molecular formula C29H36N4O6 and a molecular weight of 536.63 g/mol. Its IUPAC name is 1-N',9-N'-bis(4-prop-2-enoxybenzoyl)nonanedihydrazide.
| Compound Name | 1-N',9-N'-bis(4-prop-2-enoxybenzoyl)nonanedihydrazide |
|---|---|
| PubChem CID | 4926340 |
| Molecular Formula | C29H36N4O6 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 1-N',9-N'-bis(4-prop-2-enoxybenzoyl)nonanedihydrazide |
| SMILES | C=CCOc1ccc(C(=O)NNC(=O)CCCCCCCC(=O)NNC(=O)c2ccc(OCC=C)cc2)cc1 |
| InChI | InChI=1S/C29H36N4O6/c1-3-20-38-24-16-12-22(13-17-24)28(36)32-30-26(34)10-8-6-5-7-9-11-27(35)31-33-29(37)23-14-18-25(19-15-23)39-21-4-2/h3-4,12-19H,1-2,5-11,20-21H2,(H,30,34)(H,31,35)(H,32,36)(H,33,37) |
| InChIKey | KAJHYVULDBLDKS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|