C22H26N2O4 — CID 4945083
N'-[2-(4-tert-butylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide (PubChem CID 4945083) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N'-[2-(4-tert-butylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide.
| Compound Name | N'-[2-(4-tert-butylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide |
|---|---|
| PubChem CID | 4945083 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N'-[2-(4-tert-butylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide |
| SMILES | C=CCOc1ccc(C(=O)NNC(=O)COc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-5-14-27-18-10-6-16(7-11-18)21(26)24-23-20(25)15-28-19-12-8-17(9-13-19)22(2,3)4/h5-13H,1,14-15H2,2-4H3,(H,23,25)(H,24,26) |
| InChIKey | RTMCFYFOWFSHLH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|