C21H24N2O3 — CID 4929142
N'-(4-tert-butylbenzoyl)-2-prop-2-enoxybenzohydrazide (PubChem CID 4929142) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N'-(4-tert-butylbenzoyl)-2-prop-2-enoxybenzohydrazide.
| Compound Name | N'-(4-tert-butylbenzoyl)-2-prop-2-enoxybenzohydrazide |
|---|---|
| PubChem CID | 4929142 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N'-(4-tert-butylbenzoyl)-2-prop-2-enoxybenzohydrazide |
| SMILES | C=CCOc1ccccc1C(=O)NNC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-5-14-26-18-9-7-6-8-17(18)20(25)23-22-19(24)15-10-12-16(13-11-15)21(2,3)4/h5-13H,1,14H2,2-4H3,(H,22,24)(H,23,25) |
| InChIKey | CXJSOPCGLUFTLG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|