C15H20N2O4 — CID 137320522
tert-butyl N-[(2-prop-2-enoxybenzoyl)amino]carbamate (PubChem CID 137320522) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is tert-butyl N-[(2-prop-2-enoxybenzoyl)amino]carbamate.
| Compound Name | tert-butyl N-[(2-prop-2-enoxybenzoyl)amino]carbamate |
|---|---|
| PubChem CID | 137320522 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | tert-butyl N-[(2-prop-2-enoxybenzoyl)amino]carbamate |
| SMILES | C=CCOc1ccccc1C(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20N2O4/c1-5-10-20-12-9-7-6-8-11(12)13(18)16-17-14(19)21-15(2,3)4/h5-9H,1,10H2,2-4H3,(H,16,18)(H,17,19) |
| InChIKey | YKIYTMJNCISEEW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|