C19H20N2O4 — CID 4925883
N'-[2-(4-methylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide (PubChem CID 4925883) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N'-[2-(4-methylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide.
| Compound Name | N'-[2-(4-methylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide |
|---|---|
| PubChem CID | 4925883 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N'-[2-(4-methylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide |
| SMILES | C=CCOc1ccc(C(=O)NNC(=O)COc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-3-12-24-16-10-6-15(7-11-16)19(23)21-20-18(22)13-25-17-8-4-14(2)5-9-17/h3-11H,1,12-13H2,2H3,(H,20,22)(H,21,23) |
| InChIKey | NQHQIKOAHZMRFO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|