C20H22N2O4 — CID 2091478
N'-[4-(4-acetylphenoxy)butanoyl]-4-methylbenzohydrazide (PubChem CID 2091478) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is N'-[4-(4-acetylphenoxy)butanoyl]-4-methylbenzohydrazide.
| Compound Name | N'-[4-(4-acetylphenoxy)butanoyl]-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 2091478 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N'-[4-(4-acetylphenoxy)butanoyl]-4-methylbenzohydrazide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)NNC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-14-5-7-17(8-6-14)20(25)22-21-19(24)4-3-13-26-18-11-9-16(10-12-18)15(2)23/h5-12H,3-4,13H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | LLWBAGSRBAVHGR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|