C20H24N2O5 — CID 9492733
4-ethoxy-N'-[4-(4-methoxyphenoxy)butanoyl]benzohydrazide (PubChem CID 9492733) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-ethoxy-N'-[4-(4-methoxyphenoxy)butanoyl]benzohydrazide.
| Compound Name | 4-ethoxy-N'-[4-(4-methoxyphenoxy)butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9492733 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-ethoxy-N'-[4-(4-methoxyphenoxy)butanoyl]benzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)CCCOc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O5/c1-3-26-17-8-6-15(7-9-17)20(24)22-21-19(23)5-4-14-27-18-12-10-16(25-2)11-13-18/h6-13H,3-5,14H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | VUECJRJQSPFKDH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|