C25H32N4O6 — CID 3123941
1-N',9-N'-bis(4-methoxybenzoyl)nonanedihydrazide (PubChem CID 3123941) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is 1-N',9-N'-bis(4-methoxybenzoyl)nonanedihydrazide.
| Compound Name | 1-N',9-N'-bis(4-methoxybenzoyl)nonanedihydrazide |
|---|---|
| PubChem CID | 3123941 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 1-N',9-N'-bis(4-methoxybenzoyl)nonanedihydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CCCCCCCC(=O)NNC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H32N4O6/c1-34-20-14-10-18(11-15-20)24(32)28-26-22(30)8-6-4-3-5-7-9-23(31)27-29-25(33)19-12-16-21(35-2)17-13-19/h10-17H,3-9H2,1-2H3,(H,26,30)(H,27,31)(H,28,32)(H,29,33) |
| InChIKey | XFCYFSSRDWELMG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|