About 4-methyl-N'-octanoylbenzohydrazide
4-methyl-N'-octanoylbenzohydrazide (PubChem CID 4958769) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-methyl-N'-octanoylbenzohydrazide.
Molecular Properties
| Compound Name | 4-methyl-N'-octanoylbenzohydrazide |
| PubChem CID | 4958769 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-methyl-N'-octanoylbenzohydrazide |
| SMILES | CCCCCCCC(=O)NNC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H24N2O2/c1-3-4-5-6-7-8-15(19)17-18-16(20)14-11-9-13(2)10-12-14/h9-12H,3-8H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | SJPFECFSYABLQP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N'-octanoylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N'-octanoylbenzohydrazide?
The IUPAC name of 4-methyl-N'-octanoylbenzohydrazide (CID 4958769) is 4-methyl-N'-octanoylbenzohydrazide.
What is the SMILES notation for 4-methyl-N'-octanoylbenzohydrazide?
The canonical SMILES for 4-methyl-N'-octanoylbenzohydrazide is CCCCCCCC(=O)NNC(=O)c1ccc(C)cc1.
What is the InChIKey of 4-methyl-N'-octanoylbenzohydrazide?
The InChIKey is SJPFECFSYABLQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-3-4-5-6-7-8-15(19)17-18-16(20)14-11-9-13(2)10-12-14/h9-12H,3-8H2,1-2H3,(H,17,19)(H,18,20).
What are the key properties of 4-methyl-N'-octanoylbenzohydrazide?
4-methyl-N'-octanoylbenzohydrazide has a molecular weight of 276.38 g/mol, XLogP of 3.12, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N'-octanoylbenzohydrazide is sourced from PubChem (CID 4958769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).