C15H22N2O2 — CID 4227469
N'-octanoylbenzohydrazide (PubChem CID 4227469) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N'-octanoylbenzohydrazide.
| Compound Name | N'-octanoylbenzohydrazide |
|---|---|
| PubChem CID | 4227469 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N'-octanoylbenzohydrazide |
| SMILES | CCCCCCCC(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22N2O2/c1-2-3-4-5-9-12-14(18)16-17-15(19)13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | HOMNYQBWHBSLLU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|