C20H32N2O3 — CID 54789289
N'-heptanoyl-4-hexoxybenzohydrazide (PubChem CID 54789289) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is N'-heptanoyl-4-hexoxybenzohydrazide.
| Compound Name | N'-heptanoyl-4-hexoxybenzohydrazide |
|---|---|
| PubChem CID | 54789289 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | N'-heptanoyl-4-hexoxybenzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)CCCCCC)cc1 |
| InChI | InChI=1S/C20H32N2O3/c1-3-5-7-9-11-19(23)21-22-20(24)17-12-14-18(15-13-17)25-16-10-8-6-4-2/h12-15H,3-11,16H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | CWUZTNIDYWBAPT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|