C20H31N3O3 — CID 4958829
N-[4-[(octanoylamino)carbamoyl]phenyl]pentanamide (PubChem CID 4958829) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[4-[(octanoylamino)carbamoyl]phenyl]pentanamide.
| Compound Name | N-[4-[(octanoylamino)carbamoyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 4958829 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | N-[4-[(octanoylamino)carbamoyl]phenyl]pentanamide |
| SMILES | CCCCCCCC(=O)NNC(=O)c1ccc(NC(=O)CCCC)cc1 |
| InChI | InChI=1S/C20H31N3O3/c1-3-5-7-8-9-11-19(25)22-23-20(26)16-12-14-17(15-13-16)21-18(24)10-6-4-2/h12-15H,3-11H2,1-2H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | BCPIUHLULMIEIX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|