C30H40N6O6 — CID 4926555
N-[4-[[[6-oxo-6-[2-[4-(pentanoylamino)benzoyl]hydrazinyl]hexanoyl]amino]carbamoyl]phenyl]pentanamide (PubChem CID 4926555) has the molecular formula C30H40N6O6 and a molecular weight of 580.69 g/mol. Its IUPAC name is N-[4-[[[6-oxo-6-[2-[4-(pentanoylamino)benzoyl]hydrazinyl]hexanoyl]amino]carbamoyl]phenyl]pentanamide.
| Compound Name | N-[4-[[[6-oxo-6-[2-[4-(pentanoylamino)benzoyl]hydrazinyl]hexanoyl]amino]carbamoyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 4926555 |
| Molecular Formula | C30H40N6O6 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | N-[4-[[[6-oxo-6-[2-[4-(pentanoylamino)benzoyl]hydrazinyl]hexanoyl]amino]carbamoyl]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(C(=O)NNC(=O)CCCCC(=O)NNC(=O)c2ccc(NC(=O)CCCC)cc2)cc1 |
| InChI | InChI=1S/C30H40N6O6/c1-3-5-9-25(37)31-23-17-13-21(14-18-23)29(41)35-33-27(39)11-7-8-12-28(40)34-36-30(42)22-15-19-24(20-16-22)32-26(38)10-6-4-2/h13-20H,3-12H2,1-2H3,(H,31,37)(H,32,38)(H,33,39)(H,34,40)(H,35,41)(H,36,42) |
| InChIKey | BMHAUQFCAQSFJB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 174.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|