C28H38N4O4 — CID 17195940
N,N'-bis[4-(butylcarbamoyl)phenyl]hexanediamide (PubChem CID 17195940) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is N,N'-bis[4-(butylcarbamoyl)phenyl]hexanediamide.
| Compound Name | N,N'-bis[4-(butylcarbamoyl)phenyl]hexanediamide |
|---|---|
| PubChem CID | 17195940 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | N,N'-bis[4-(butylcarbamoyl)phenyl]hexanediamide |
| SMILES | CCCCNC(=O)c1ccc(NC(=O)CCCCC(=O)Nc2ccc(C(=O)NCCCC)cc2)cc1 |
| InChI | InChI=1S/C28H38N4O4/c1-3-5-19-29-27(35)21-11-15-23(16-12-21)31-25(33)9-7-8-10-26(34)32-24-17-13-22(14-18-24)28(36)30-20-6-4-2/h11-18H,3-10,19-20H2,1-2H3,(H,29,35)(H,30,36)(H,31,33)(H,32,34) |
| InChIKey | WXOUUJDTLOPCNT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|