C24H32N4O3 — CID 54832366
N-butyl-4-[[2-[4-(butylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54832366) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-butyl-4-[[2-[4-(butylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-butyl-4-[[2-[4-(butylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54832366 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N-butyl-4-[[2-[4-(butylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CCCCNC(=O)c1ccc(NCC(=O)Nc2ccc(C(=O)NCCCC)cc2)cc1 |
| InChI | InChI=1S/C24H32N4O3/c1-3-5-15-25-23(30)18-7-11-20(12-8-18)27-17-22(29)28-21-13-9-19(10-14-21)24(31)26-16-6-4-2/h7-14,27H,3-6,15-17H2,1-2H3,(H,25,30)(H,26,31)(H,28,29) |
| InChIKey | ZVMOVTRKBRBPQS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|