C22H28N4O3 — CID 54811232
4-[[2-[4-[acetyl(methyl)amino]anilino]acetyl]amino]-N-butylbenzamide (PubChem CID 54811232) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-[[2-[4-[acetyl(methyl)amino]anilino]acetyl]amino]-N-butylbenzamide.
| Compound Name | 4-[[2-[4-[acetyl(methyl)amino]anilino]acetyl]amino]-N-butylbenzamide |
|---|---|
| PubChem CID | 54811232 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 4-[[2-[4-[acetyl(methyl)amino]anilino]acetyl]amino]-N-butylbenzamide |
| SMILES | CCCCNC(=O)c1ccc(NC(=O)CNc2ccc(N(C)C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-4-5-14-23-22(29)17-6-8-19(9-7-17)25-21(28)15-24-18-10-12-20(13-11-18)26(3)16(2)27/h6-13,24H,4-5,14-15H2,1-3H3,(H,23,29)(H,25,28) |
| InChIKey | OGCWKOAKNYEHBF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|