C26H34N4O6 — CID 17218594
N,N'-bis[4-(2-methoxyethylcarbamoyl)phenyl]hexanediamide (PubChem CID 17218594) has the molecular formula C26H34N4O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is N,N'-bis[4-(2-methoxyethylcarbamoyl)phenyl]hexanediamide.
| Compound Name | N,N'-bis[4-(2-methoxyethylcarbamoyl)phenyl]hexanediamide |
|---|---|
| PubChem CID | 17218594 |
| Molecular Formula | C26H34N4O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | N,N'-bis[4-(2-methoxyethylcarbamoyl)phenyl]hexanediamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)CCCCC(=O)Nc2ccc(C(=O)NCCOC)cc2)cc1 |
| InChI | InChI=1S/C26H34N4O6/c1-35-17-15-27-25(33)19-7-11-21(12-8-19)29-23(31)5-3-4-6-24(32)30-22-13-9-20(10-14-22)26(34)28-16-18-36-2/h7-14H,3-6,15-18H2,1-2H3,(H,27,33)(H,28,34)(H,29,31)(H,30,32) |
| InChIKey | BOVKTFSSHMARGT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|