C19H20N2O4 — CID 109045198
4-N-(4-acetylphenyl)-1-N-(2-methoxyethyl)benzene-1,4-dicarboxamide (PubChem CID 109045198) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-N-(4-acetylphenyl)-1-N-(2-methoxyethyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(4-acetylphenyl)-1-N-(2-methoxyethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109045198 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-N-(4-acetylphenyl)-1-N-(2-methoxyethyl)benzene-1,4-dicarboxamide |
| SMILES | COCCNC(=O)c1ccc(C(=O)Nc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-13(22)14-7-9-17(10-8-14)21-19(24)16-5-3-15(4-6-16)18(23)20-11-12-25-2/h3-10H,11-12H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | YLFGKYLIECXGFZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|