C18H17N3O3 — CID 109045241
4-N-(4-cyanophenyl)-1-N-(2-methoxyethyl)benzene-1,4-dicarboxamide (PubChem CID 109045241) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 4-N-(4-cyanophenyl)-1-N-(2-methoxyethyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(4-cyanophenyl)-1-N-(2-methoxyethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109045241 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-N-(4-cyanophenyl)-1-N-(2-methoxyethyl)benzene-1,4-dicarboxamide |
| SMILES | COCCNC(=O)c1ccc(C(=O)Nc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O3/c1-24-11-10-20-17(22)14-4-6-15(7-5-14)18(23)21-16-8-2-13(12-19)3-9-16/h2-9H,10-11H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | TVODUEUNUNFBIE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|