C23H18FN3O2 — CID 109047977
4-N-(4-cyanophenyl)-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,4-dicarboxamide (PubChem CID 109047977) has the molecular formula C23H18FN3O2 and a molecular weight of 387.41 g/mol. Its IUPAC name is 4-N-(4-cyanophenyl)-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(4-cyanophenyl)-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109047977 |
| Molecular Formula | C23H18FN3O2 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-N-(4-cyanophenyl)-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,4-dicarboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccc(C(=O)NCCc3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C23H18FN3O2/c24-21-4-2-1-3-17(21)13-14-26-22(28)18-7-9-19(10-8-18)23(29)27-20-11-5-16(15-25)6-12-20/h1-12H,13-14H2,(H,26,28)(H,27,29) |
| InChIKey | JIWOUFWHOMKXLT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |