C24H23FN2O2 — CID 109055398
3-N-(4-ethylphenyl)-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,3-dicarboxamide (PubChem CID 109055398) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is 3-N-(4-ethylphenyl)-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-(4-ethylphenyl)-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109055398 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 3-N-(4-ethylphenyl)-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,3-dicarboxamide |
| SMILES | CCc1ccc(NC(=O)c2cccc(C(=O)NCCc3ccccc3F)c2)cc1 |
| InChI | InChI=1S/C24H23FN2O2/c1-2-17-10-12-21(13-11-17)27-24(29)20-8-5-7-19(16-20)23(28)26-15-14-18-6-3-4-9-22(18)25/h3-13,16H,2,14-15H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | KQSADZTUKOGPKR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |