C23H21FN2O3 — CID 109055517
3-N-(4-fluorophenyl)-1-N-[2-(4-methoxyphenyl)ethyl]benzene-1,3-dicarboxamide (PubChem CID 109055517) has the molecular formula C23H21FN2O3 and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-N-(4-fluorophenyl)-1-N-[2-(4-methoxyphenyl)ethyl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-(4-fluorophenyl)-1-N-[2-(4-methoxyphenyl)ethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109055517 |
| Molecular Formula | C23H21FN2O3 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-N-(4-fluorophenyl)-1-N-[2-(4-methoxyphenyl)ethyl]benzene-1,3-dicarboxamide |
| SMILES | COc1ccc(CCNC(=O)c2cccc(C(=O)Nc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C23H21FN2O3/c1-29-21-11-5-16(6-12-21)13-14-25-22(27)17-3-2-4-18(15-17)23(28)26-20-9-7-19(24)8-10-20/h2-12,15H,13-14H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | MDBSRKMUTKASCC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |