C25H25FN2O5 — CID 16552543
4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxy-N-[2-(4-methoxyphenyl)ethyl]benzamide (PubChem CID 16552543) has the molecular formula C25H25FN2O5 and a molecular weight of 452.48 g/mol. Its IUPAC name is 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxy-N-[2-(4-methoxyphenyl)ethyl]benzamide.
| Compound Name | 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxy-N-[2-(4-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 16552543 |
| Molecular Formula | C25H25FN2O5 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxy-N-[2-(4-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(OCC(=O)Nc3ccc(F)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H25FN2O5/c1-31-21-10-3-17(4-11-21)13-14-27-25(30)18-5-12-22(23(15-18)32-2)33-16-24(29)28-20-8-6-19(26)7-9-20/h3-12,15H,13-14,16H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | UTDCHTGWEMIOCF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |