C24H23FN2O4 — CID 4798518
4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxy-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 4798518) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxy-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxy-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 4798518 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxy-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(C)cc2)ccc1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H23FN2O4/c1-16-3-5-17(6-4-16)14-26-24(29)18-7-12-21(22(13-18)30-2)31-15-23(28)27-20-10-8-19(25)9-11-20/h3-13H,14-15H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | XYOSFHRBXPRGGM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |