C24H21F3N2O6 — CID 16552258
3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 16552258) has the molecular formula C24H21F3N2O6 and a molecular weight of 490.43 g/mol. Its IUPAC name is 3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 16552258 |
| Molecular Formula | C24H21F3N2O6 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(C(=O)Nc3ccc(OC(F)(F)F)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C24H21F3N2O6/c1-32-18-8-4-16(5-9-18)28-22(30)14-34-20-12-3-15(13-21(20)33-2)23(31)29-17-6-10-19(11-7-17)35-24(25,26)27/h3-13H,14H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | WWZRJPKCVQOYIS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |