C25H26N2O5 — CID 108935771
N-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]phenyl]-3,4-dimethoxybenzamide (PubChem CID 108935771) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is N-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 108935771 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(NC(=O)COc3ccc(C)cc3C)cc2)cc1OC |
| InChI | InChI=1S/C25H26N2O5/c1-16-5-11-21(17(2)13-16)32-15-24(28)26-19-7-9-20(10-8-19)27-25(29)18-6-12-22(30-3)23(14-18)31-4/h5-14H,15H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | UZZHEKHYIVIBLX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |