C19H21NO5 — CID 894367
methyl 2-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]phenoxy]acetate (PubChem CID 894367) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl 2-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 894367 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | methyl 2-[4-[[2-(2,4-dimethylphenoxy)acetyl]amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)COc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H21NO5/c1-13-4-9-17(14(2)10-13)25-11-18(21)20-15-5-7-16(8-6-15)24-12-19(22)23-3/h4-10H,11-12H2,1-3H3,(H,20,21) |
| InChIKey | KUKWDPALRDNYHH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |