C21H17FN2O3 — CID 109057463
1-N-(4-fluorophenyl)-3-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide (PubChem CID 109057463) has the molecular formula C21H17FN2O3 and a molecular weight of 364.38 g/mol. Its IUPAC name is 1-N-(4-fluorophenyl)-3-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-(4-fluorophenyl)-3-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109057463 |
| Molecular Formula | C21H17FN2O3 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-N-(4-fluorophenyl)-3-N-(3-methoxyphenyl)benzene-1,3-dicarboxamide |
| SMILES | COc1cccc(NC(=O)c2cccc(C(=O)Nc3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C21H17FN2O3/c1-27-19-7-3-6-18(13-19)24-21(26)15-5-2-4-14(12-15)20(25)23-17-10-8-16(22)9-11-17/h2-13H,1H3,(H,23,25)(H,24,26) |
| InChIKey | JNDWBGCFKBRUCP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |