C22H17N2O5- — CID 4077385
4-[[3-[(3-methoxybenzoyl)amino]benzoyl]amino]benzoate (PubChem CID 4077385) has the molecular formula C22H17N2O5- and a molecular weight of 389.39 g/mol. Its IUPAC name is 4-[[3-[(3-methoxybenzoyl)amino]benzoyl]amino]benzoate.
| Compound Name | 4-[[3-[(3-methoxybenzoyl)amino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 4077385 |
| Molecular Formula | C22H17N2O5- |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 4-[[3-[(3-methoxybenzoyl)amino]benzoyl]amino]benzoate |
| SMILES | COc1cccc(C(=O)Nc2cccc(C(=O)Nc3ccc(C(=O)[O-])cc3)c2)c1 |
| InChI | InChI=1S/C22H18N2O5/c1-29-19-7-3-5-16(13-19)21(26)24-18-6-2-4-15(12-18)20(25)23-17-10-8-14(9-11-17)22(27)28/h2-13H,1H3,(H,23,25)(H,24,26)(H,27,28)/p-1 |
| InChIKey | YXCWSGZFSAPDRD-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |