C16H14NO5- — CID 3699347
4-[(3,5-dimethoxybenzoyl)amino]benzoate (PubChem CID 3699347) has the molecular formula C16H14NO5- and a molecular weight of 300.29 g/mol. Its IUPAC name is 4-[(3,5-dimethoxybenzoyl)amino]benzoate.
| Compound Name | 4-[(3,5-dimethoxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 3699347 |
| Molecular Formula | C16H14NO5- |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-[(3,5-dimethoxybenzoyl)amino]benzoate |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(C(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C16H15NO5/c1-21-13-7-11(8-14(9-13)22-2)15(18)17-12-5-3-10(4-6-12)16(19)20/h3-9H,1-2H3,(H,17,18)(H,19,20)/p-1 |
| InChIKey | JATNUSRFNLGCIJ-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |