C16H15F2NO5S — CID 2671265
N-[4-(difluoromethylsulfonyl)phenyl]-3,5-dimethoxybenzamide (PubChem CID 2671265) has the molecular formula C16H15F2NO5S and a molecular weight of 371.36 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfonyl)phenyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[4-(difluoromethylsulfonyl)phenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 2671265 |
| Molecular Formula | C16H15F2NO5S |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-[4-(difluoromethylsulfonyl)phenyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(S(=O)(=O)C(F)F)cc2)c1 |
| InChI | InChI=1S/C16H15F2NO5S/c1-23-12-7-10(8-13(9-12)24-2)15(20)19-11-3-5-14(6-4-11)25(21,22)16(17)18/h3-9,16H,1-2H3,(H,19,20) |
| InChIKey | RKGUBDCDYYQRKP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |