C9H9LiO4 — CID 19205782
lithium 3,5-dimethoxybenzoate (PubChem CID 19205782) has the molecular formula C9H9LiO4 and a molecular weight of 188.11 g/mol. Its IUPAC name is lithium 3,5-dimethoxybenzoate.
| Compound Name | lithium 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 19205782 |
| Molecular Formula | C9H9LiO4 |
| Molecular Weight | 188.11 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | lithium 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)[O-])c1.[Li+] |
| InChI | InChI=1S/C9H10O4.Li/c1-12-7-3-6(9(10)11)4-8(5-7)13-2;/h3-5H,1-2H3,(H,10,11);/q;+1/p-1 |
| InChIKey | QPHJWIWWZRJJRM-UHFFFAOYSA-M |
| XLogP | -2.93 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.11 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |