C10H16N2O4 — CID 174919725
1,3,5-trimethoxybenzene;urea (PubChem CID 174919725) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1,3,5-trimethoxybenzene;urea.
| Compound Name | 1,3,5-trimethoxybenzene;urea |
|---|---|
| PubChem CID | 174919725 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1,3,5-trimethoxybenzene;urea |
| SMILES | COc1cc(OC)cc(OC)c1.NC(N)=O |
| InChI | InChI=1S/C9H12O3.CH4N2O/c1-10-7-4-8(11-2)6-9(5-7)12-3;2-1(3)4/h4-6H,1-3H3;(H4,2,3,4) |
| InChIKey | OATSUQKXYYQZFQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |