C12H18O3 — CID 142226820
1-(3,5-dimethoxyphenyl)ethanone;ethane (PubChem CID 142226820) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)ethanone;ethane.
| Compound Name | 1-(3,5-dimethoxyphenyl)ethanone;ethane |
|---|---|
| PubChem CID | 142226820 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)ethanone;ethane |
| SMILES | CC.COc1cc(OC)cc(C(C)=O)c1 |
| InChI | InChI=1S/C10H12O3.C2H6/c1-7(11)8-4-9(12-2)6-10(5-8)13-3;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | KMCHTJYGAAFYEO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |